CAS 849035-82-1 is the registry number for (2E)-3-[4-Chloro-2-(methylsulfonyl)phenyl]acrylic acid, 95%. Offered by: Fluorochem. Available pack sizes: 5g.
3-(4-chloro-2-methylsulfonylphenyl)prop-2-enoic acid (CAS 849035-82-1) is a chemical compound with the molecular formula C10H9ClO4S and a molecular weight of 260.69 g/mol. IUPAC name: 3-(4-chloro-2-methylsulfonylphenyl)prop-2-enoic acid. InChIKey: MIPMROMSCSKIEH-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO4S |
|---|---|
| Molecular weight | 260.69 g/mol |
| IUPAC name | 3-(4-chloro-2-methylsulfonylphenyl)prop-2-enoic acid |
| InChIKey | MIPMROMSCSKIEH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=CC(=C1)Cl)C=CC(=O)O |
Computed by PubChem (NCBI)