CAS 1368134-86-4 appears in our catalog under these names: 5-(Chlorosulfonyl)-2,3-dihydro-1H-indene-2-carboxylic acid, 95%, 5-(Chlorosulfonyl)-2,3-dihydro-1H-indene-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-chlorosulfonyl-2,3-dihydro-1H-indene-2-carboxylic acid (CAS 1368134-86-4) is a chemical compound with the molecular formula C10H9ClO4S and a molecular weight of 260.69 g/mol. IUPAC name: 5-chlorosulfonyl-2,3-dihydro-1H-indene-2-carboxylic acid. InChIKey: YLDSIFMBUXXODJ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO4S |
|---|---|
| Molecular weight | 260.69 g/mol |
| IUPAC name | 5-chlorosulfonyl-2,3-dihydro-1H-indene-2-carboxylic acid |
| InChIKey | YLDSIFMBUXXODJ-UHFFFAOYSA-N |
| SMILES | C1C(CC2=C1C=CC(=C2)S(=O)(=O)Cl)C(=O)O |
Computed by PubChem (NCBI)