CAS 1183614-36-9 is the registry number for ([2-(3,4-Dichlorophenyl)phenyl]methyl)(methyl)amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-[2-(3,4-dichlorophenyl)phenyl]-N-methylmethanamine (CAS 1183614-36-9) is a chemical compound with the molecular formula C14H13Cl2N and a molecular weight of 266.2 g/mol. IUPAC name: 1-[2-(3,4-dichlorophenyl)phenyl]-N-methylmethanamine. InChIKey: YGUPLDQLNVUITA-UHFFFAOYSA-N.
| Molecular formula | C14H13Cl2N |
|---|---|
| Molecular weight | 266.2 g/mol |
| IUPAC name | 1-[2-(3,4-dichlorophenyl)phenyl]-N-methylmethanamine |
| InChIKey | YGUPLDQLNVUITA-UHFFFAOYSA-N |
| SMILES | CNCC1=CC=CC=C1C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)