CAS 129041-31-2 appears in our catalog under these names: Bis(3-chlorobenzyl)amine, 98%, N,N–Bis(3–chlorobenzyl)amine, bis[(3-chlorophenyl)methyl]amine, 98%, 98%, Bis(3-chlorobenzyl)amine, 98%(HPLC),RG. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 100mg, 250mg.
1-(3-chlorophenyl)-N-[(3-chlorophenyl)methyl]methanamine (CAS 129041-31-2) is a chemical compound with the molecular formula C14H13Cl2N and a molecular weight of 266.2 g/mol. IUPAC name: 1-(3-chlorophenyl)-N-[(3-chlorophenyl)methyl]methanamine. InChIKey: DNKUGPCGNWRIJJ-UHFFFAOYSA-N.
| Molecular formula | C14H13Cl2N |
|---|---|
| Molecular weight | 266.2 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-N-[(3-chlorophenyl)methyl]methanamine |
| InChIKey | DNKUGPCGNWRIJJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CNCC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)