CAS 14501-87-2 is the registry number for N-Benzyl-1-(2,4-dichlorophenyl)methanamine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
N-[(2,4-dichlorophenyl)methyl]-1-phenylmethanamine (CAS 14501-87-2) is a chemical compound with the molecular formula C14H13Cl2N and a molecular weight of 266.2 g/mol. IUPAC name: N-[(2,4-dichlorophenyl)methyl]-1-phenylmethanamine. InChIKey: RJIXZWDWKCJXBS-UHFFFAOYSA-N.
| Molecular formula | C14H13Cl2N |
|---|---|
| Molecular weight | 266.2 g/mol |
| IUPAC name | N-[(2,4-dichlorophenyl)methyl]-1-phenylmethanamine |
| InChIKey | RJIXZWDWKCJXBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNCC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)