Products 1335304-50-1
CAS 1335304-50-1 is the registry number for (4-Chloro-2-methylphenyl)(4-chlorophenyl)methanamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(4-chloro-2-methylphenyl)-(4-chlorophenyl)methanamine (CAS 1335304-50-1) is a chemical compound with the molecular formula C14H13Cl2N and a molecular weight of 266.2 g/mol. IUPAC name: (4-chloro-2-methylphenyl)-(4-chlorophenyl)methanamine. InChIKey: YWSZVZWWIPUDIZ-UHFFFAOYSA-N.
| Molecular formula | C14H13Cl2N |
|---|---|
| Molecular weight | 266.2 g/mol |
| IUPAC name | (4-chloro-2-methylphenyl)-(4-chlorophenyl)methanamine |
| InChIKey | YWSZVZWWIPUDIZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)C(C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)