Products 1183803-32-8
CAS 1183803-32-8 is the registry number for 5-Chloro-3-(3-phenoxyphenyl)-1,2,4-oxadiazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-chloro-3-(3-phenoxyphenyl)-1,2,4-oxadiazole (CAS 1183803-32-8) is a chemical compound with the molecular formula C14H9ClN2O2 and a molecular weight of 272.68 g/mol. IUPAC name: 5-chloro-3-(3-phenoxyphenyl)-1,2,4-oxadiazole. InChIKey: UVORXEAUVSBUDO-UHFFFAOYSA-N.
| Molecular formula | C14H9ClN2O2 |
|---|---|
| Molecular weight | 272.68 g/mol |
| IUPAC name | 5-chloro-3-(3-phenoxyphenyl)-1,2,4-oxadiazole |
| InChIKey | UVORXEAUVSBUDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C3=NOC(=N3)Cl |
Computed by PubChem (NCBI)