CAS 1183972-27-1 appears in our catalog under these names: 1-(2-Methoxyethyl)-3,5-dimethyl-1H-pyrazole-4-sulfonyl chloride, 95%, 1-(2-Methoxyethyl)-3,5-dimethyl-1H-pyrazole-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(2-methoxyethyl)-3,5-dimethylpyrazole-4-sulfonyl chloride (CAS 1183972-27-1) is a chemical compound with the molecular formula C8H13ClN2O3S and a molecular weight of 252.72 g/mol. IUPAC name: 1-(2-methoxyethyl)-3,5-dimethylpyrazole-4-sulfonyl chloride. InChIKey: MPAOKWAEHWIBKZ-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O3S |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 1-(2-methoxyethyl)-3,5-dimethylpyrazole-4-sulfonyl chloride |
| InChIKey | MPAOKWAEHWIBKZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CCOC)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)