CAS 83209-83-0 appears in our catalog under these names: N-(4-Amino-3-methoxyphenyl)methanesulfonamide hydrochloride, 95%, N-(4-Amino-3-methoxyphenyl)methanesulfonamidehydrochloride, N-(4-Amino-3-methoxyphenyl)methanesulfonamide hydrochloride 97%, N-(4-AMINO-3-METHOXYPHENYL)METHANESULFONAMIDE HCL, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 25g, 250mg, 2,5g.
N-(4-amino-3-methoxyphenyl)methanesulfonamide;hydrochloride (CAS 83209-83-0) is a chemical compound with the molecular formula C8H13ClN2O3S and a molecular weight of 252.72 g/mol. IUPAC name: N-(4-amino-3-methoxyphenyl)methanesulfonamide;hydrochloride. InChIKey: PWXSODKMZNUMBY-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O3S |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | N-(4-amino-3-methoxyphenyl)methanesulfonamide;hydrochloride |
| InChIKey | PWXSODKMZNUMBY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)NS(=O)(=O)C)N.Cl |
Computed by PubChem (NCBI)