CAS 83763-35-3 is the registry number for 3-Amino-4-hydroxy-n,n-dimethylbenzene-1-sulfonamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
3-amino-4-hydroxy-N,N-dimethylbenzenesulfonamide;hydrochloride (CAS 83763-35-3) is a chemical compound with the molecular formula C8H13ClN2O3S and a molecular weight of 252.72 g/mol. IUPAC name: 3-amino-4-hydroxy-N,N-dimethylbenzenesulfonamide;hydrochloride. InChIKey: VFCMSRKNRBRJGK-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O3S |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 3-amino-4-hydroxy-N,N-dimethylbenzenesulfonamide;hydrochloride |
| InChIKey | VFCMSRKNRBRJGK-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=C(C=C1)O)N.Cl |
Computed by PubChem (NCBI)