CAS 1638351-23-1 appears in our catalog under these names: (4-Chlorobenzyl)hydrazine methanesulfonate, 95%, (4-Chlorobenzyl)hydrazine methanesulfonate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(4-chlorophenyl)methylhydrazine;methanesulfonic acid (CAS 1638351-23-1) is a chemical compound with the molecular formula C8H13ClN2O3S and a molecular weight of 252.72 g/mol. IUPAC name: (4-chlorophenyl)methylhydrazine;methanesulfonic acid. InChIKey: GACLHBBGGSQKEQ-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O3S |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | (4-chlorophenyl)methylhydrazine;methanesulfonic acid |
| InChIKey | GACLHBBGGSQKEQ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1=CC(=CC=C1CNN)Cl |
Computed by PubChem (NCBI)