CAS 1183992-83-7 appears in our catalog under these names: 1-(Cyclopropylmethyl)-3,5-dimethyl-1H-pyrazole-4-sulfonyl chloride, 95%, 1-(Cyclopropylmethyl)-3,5-dimethyl-1H-pyrazole-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(cyclopropylmethyl)-3,5-dimethylpyrazole-4-sulfonyl chloride (CAS 1183992-83-7) is a chemical compound with the molecular formula C9H13ClN2O2S and a molecular weight of 248.73 g/mol. IUPAC name: 1-(cyclopropylmethyl)-3,5-dimethylpyrazole-4-sulfonyl chloride. InChIKey: HDSFNXIOMAMBQV-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2S |
|---|---|
| Molecular weight | 248.73 g/mol |
| IUPAC name | 1-(cyclopropylmethyl)-3,5-dimethylpyrazole-4-sulfonyl chloride |
| InChIKey | HDSFNXIOMAMBQV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC2CC2)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)