CAS 1184135-28-1 appears in our catalog under these names: 5-Fluoro-N1-(2,2,2-trifluoroethyl)benzene-1,3-diamine, 95%, 5-Fluoro-N1-(2,2,2-trifluoroethyl)benzene-1,3-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-fluoro-3-N-(2,2,2-trifluoroethyl)benzene-1,3-diamine (CAS 1184135-28-1) is a chemical compound with the molecular formula C8H8F4N2 and a molecular weight of 208.16 g/mol. IUPAC name: 5-fluoro-3-N-(2,2,2-trifluoroethyl)benzene-1,3-diamine. InChIKey: YNSUTJWETGXLIS-UHFFFAOYSA-N.
| Molecular formula | C8H8F4N2 |
|---|---|
| Molecular weight | 208.16 g/mol |
| IUPAC name | 5-fluoro-3-N-(2,2,2-trifluoroethyl)benzene-1,3-diamine |
| InChIKey | YNSUTJWETGXLIS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1NCC(F)(F)F)F)N |
Computed by PubChem (NCBI)