CAS 89992-50-7 appears in our catalog under these names: 2,3,5,6-Tetrafluoro-1,4-benzenedimethanamine, 95%, (Perfluoro-1,4-phenylene)dimethanamine 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
[4-(aminomethyl)-2,3,5,6-tetrafluorophenyl]methanamine (CAS 89992-50-7) is a chemical compound with the molecular formula C8H8F4N2 and a molecular weight of 208.16 g/mol. IUPAC name: [4-(aminomethyl)-2,3,5,6-tetrafluorophenyl]methanamine. InChIKey: SLOZZSUAGFSGIC-UHFFFAOYSA-N.
| Molecular formula | C8H8F4N2 |
|---|---|
| Molecular weight | 208.16 g/mol |
| IUPAC name | [4-(aminomethyl)-2,3,5,6-tetrafluorophenyl]methanamine |
| InChIKey | SLOZZSUAGFSGIC-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1F)F)CN)F)F)N |
Computed by PubChem (NCBI)