CAS 1213410-05-9 is the registry number for (S)-4-(1-Amino-2,2,2-trifluoroethyl)-2-fluoroaniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(1S)-1-amino-2,2,2-trifluoroethyl]-2-fluoroaniline (CAS 1213410-05-9) is a chemical compound with the molecular formula C8H8F4N2 and a molecular weight of 208.16 g/mol. IUPAC name: 4-[(1S)-1-amino-2,2,2-trifluoroethyl]-2-fluoroaniline. InChIKey: AWOHCFSDRVQOKW-ZETCQYMHSA-N.
| Molecular formula | C8H8F4N2 |
|---|---|
| Molecular weight | 208.16 g/mol |
| IUPAC name | 4-[(1S)-1-amino-2,2,2-trifluoroethyl]-2-fluoroaniline |
| InChIKey | AWOHCFSDRVQOKW-ZETCQYMHSA-N |
| SMILES | C1=CC(=C(C=C1[C@@H](C(F)(F)F)N)F)N |
Computed by PubChem (NCBI)