CAS 1337383-68-2 is the registry number for 3-(1-Amino-2,2,2-trifluoroethyl)-2-fluoroaniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(1-amino-2,2,2-trifluoroethyl)-2-fluoroaniline (CAS 1337383-68-2) is a chemical compound with the molecular formula C8H8F4N2 and a molecular weight of 208.16 g/mol. IUPAC name: 3-(1-amino-2,2,2-trifluoroethyl)-2-fluoroaniline. InChIKey: YGRAUONZEGMBMX-UHFFFAOYSA-N.
| Molecular formula | C8H8F4N2 |
|---|---|
| Molecular weight | 208.16 g/mol |
| IUPAC name | 3-(1-amino-2,2,2-trifluoroethyl)-2-fluoroaniline |
| InChIKey | YGRAUONZEGMBMX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)F)C(C(F)(F)F)N |
Computed by PubChem (NCBI)