Products 1398503-97-3
CAS 1398503-97-3 appears in our catalog under these names: 3-Methyl-6,7-dihydro-5h-cyclopenta[c]pyridin-7-amine hydrochloride, 95%, 3-Methyl-6,7-dihydro-5H-cyclopenta(c)pyridin-7-amine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
3-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-7-amine;hydrochloride (CAS 1398503-97-3) is a chemical compound with the molecular formula C9H13ClN2 and a molecular weight of 184.66 g/mol. IUPAC name: 3-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-7-amine;hydrochloride. InChIKey: ALTPNOLRPVJZKJ-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2 |
|---|---|
| Molecular weight | 184.66 g/mol |
| IUPAC name | 3-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-7-amine;hydrochloride |
| InChIKey | ALTPNOLRPVJZKJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=N1)C(CC2)N.Cl |
Computed by PubChem (NCBI)