Products 1184914-87-1

CAS 1184914-87-1 is the registry number for Ipratropium Bromide Impurity 47. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3-hydroxy-2-phenylpropanoyl)oxy-2-phenylpropanoic acid (CAS 1184914-87-1) is a chemical compound with the molecular formula C18H18O5 and a molecular weight of 314.3 g/mol. IUPAC name: 3-(3-hydroxy-2-phenylpropanoyl)oxy-2-phenylpropanoic acid. InChIKey: DOKFTILTBKIDSG-UHFFFAOYSA-N.

Identity
Molecular formulaC18H18O5
Molecular weight314.3 g/mol
IUPAC name3-(3-hydroxy-2-phenylpropanoyl)oxy-2-phenylpropanoic acid
InChIKeyDOKFTILTBKIDSG-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(CO)C(=O)OCC(C2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)