CAS 1184934-40-4 is the registry number for 1-Butanol, 4-azido-, 1-benzoate. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-azidobutyl benzoate (CAS 1184934-40-4) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: 4-azidobutyl benzoate. InChIKey: CISOTFNZYJORQK-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 4-azidobutyl benzoate |
| InChIKey | CISOTFNZYJORQK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OCCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)