CAS 1184983-27-4 is the registry number for Methylphenobarbital-d3. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
5-ethyl-5-phenyl-1-(trideuteriomethyl)-1,3-diazinane-2,4,6-trione (CAS 1184983-27-4) is a chemical compound with the molecular formula C13H14N2O3 and a molecular weight of 249.28 g/mol. IUPAC name: 5-ethyl-5-phenyl-1-(trideuteriomethyl)-1,3-diazinane-2,4,6-trione. InChIKey: ALARQZQTBTVLJV-BMSJAHLVSA-N.
| Molecular formula | C13H14N2O3 |
|---|---|
| Molecular weight | 249.28 g/mol |
| IUPAC name | 5-ethyl-5-phenyl-1-(trideuteriomethyl)-1,3-diazinane-2,4,6-trione |
| InChIKey | ALARQZQTBTVLJV-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=O)C(C(=O)NC1=O)(CC)C2=CC=CC=C2 |
Computed by PubChem (NCBI)