Products 1184989-97-6
CAS 1184989-97-6 appears in our catalog under these names: 2-(3-(Trifluoromethyl)phenyl)piperidine hydrochloride, 2-(3-(Trifluoromethyl)phenyl)piperidine hydrochloride, 95%, 2-[3-(trifluoromethyl)phenyl]piperidine hydrochloride, 95%. Offered by: Biosynth, Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-[3-(trifluoromethyl)phenyl]piperidine;hydrochloride (CAS 1184989-97-6) is a chemical compound with the molecular formula C12H15ClF3N and a molecular weight of 265.70 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]piperidine;hydrochloride. InChIKey: MCMUPPZQMBYUAO-UHFFFAOYSA-N.
| Molecular formula | C12H15ClF3N |
|---|---|
| Molecular weight | 265.70 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]piperidine;hydrochloride |
| InChIKey | MCMUPPZQMBYUAO-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2=CC(=CC=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)