Products 1184990-56-4
CAS 1184990-56-4 appears in our catalog under these names: N-(4-(Benzyloxy)-3-(methylthio)phenyl)acetamide-d3, O-Benzyl-S-(methyl-d3)-3-thioacetaminophen. Offered by: MedChemExpress, TRC. Available pack sizes: 100 mg, 10 mg, 100mg, 10mg.
N-[4-phenylmethoxy-3-(trideuteriomethylsulfanyl)phenyl]acetamide (CAS 1184990-56-4) is a chemical compound with the molecular formula C16H17NO2S and a molecular weight of 290.4 g/mol. IUPAC name: N-[4-phenylmethoxy-3-(trideuteriomethylsulfanyl)phenyl]acetamide. InChIKey: UXXSZZVZHGEQNZ-BMSJAHLVSA-N.
| Molecular formula | C16H17NO2S |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | N-[4-phenylmethoxy-3-(trideuteriomethylsulfanyl)phenyl]acetamide |
| InChIKey | UXXSZZVZHGEQNZ-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])SC1=C(C=CC(=C1)NC(=O)C)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)