CAS 1184997-37-2 appears in our catalog under these names: N-(4-(Aminomethyl)phenyl)benzo[d]isoxazol-3-amine hydrochloride, 95%, N-(4-(Aminomethyl)phenyl)benzo(d)isoxazol-3-amine Hydrochloride, N-(4-(Aminomethyl)phenyl)benzo(d)isoxazol-3-amine hydrochloride, 95%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
N-[4-(aminomethyl)phenyl]-1,2-benzoxazol-3-amine;hydrochloride (CAS 1184997-37-2) is a chemical compound with the molecular formula C14H14ClN3O and a molecular weight of 275.73 g/mol. IUPAC name: N-[4-(aminomethyl)phenyl]-1,2-benzoxazol-3-amine;hydrochloride. InChIKey: VSTINLFIPODXAR-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN3O |
|---|---|
| Molecular weight | 275.73 g/mol |
| IUPAC name | N-[4-(aminomethyl)phenyl]-1,2-benzoxazol-3-amine;hydrochloride |
| InChIKey | VSTINLFIPODXAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NO2)NC3=CC=C(C=C3)CN.Cl |
Computed by PubChem (NCBI)