Products 1275694-37-5
CAS 1275694-37-5 is the registry number for 3-((3-Aminophenyl)methyl)-1-(2-chlorophenyl)urea. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[(3-aminophenyl)methyl]-3-(2-chlorophenyl)urea (CAS 1275694-37-5) is a chemical compound with the molecular formula C14H14ClN3O and a molecular weight of 275.73 g/mol. IUPAC name: 1-[(3-aminophenyl)methyl]-3-(2-chlorophenyl)urea. InChIKey: SCLMRQOWAZSFLX-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN3O |
|---|---|
| Molecular weight | 275.73 g/mol |
| IUPAC name | 1-[(3-aminophenyl)methyl]-3-(2-chlorophenyl)urea |
| InChIKey | SCLMRQOWAZSFLX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)NCC2=CC(=CC=C2)N)Cl |
Computed by PubChem (NCBI)