CAS 478049-02-4 is the registry number for 4-Chloro-2-(4-methylphenyl)-5-[(prop-2-en-1-yl)amino]-2,3-dihydropyridazin-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-chloro-2-(4-methylphenyl)-5-(prop-2-enylamino)pyridazin-3-one (CAS 478049-02-4) is a chemical compound with the molecular formula C14H14ClN3O and a molecular weight of 275.73 g/mol. IUPAC name: 4-chloro-2-(4-methylphenyl)-5-(prop-2-enylamino)pyridazin-3-one. InChIKey: ZFFLMXFLQCQDAX-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN3O |
|---|---|
| Molecular weight | 275.73 g/mol |
| IUPAC name | 4-chloro-2-(4-methylphenyl)-5-(prop-2-enylamino)pyridazin-3-one |
| InChIKey | ZFFLMXFLQCQDAX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=O)C(=C(C=N2)NCC=C)Cl |
Computed by PubChem (NCBI)