CAS 87628-32-8 is the registry number for 1-(3-(3-Chlorophenyl)-1,4,6,7-tetrahydro-5H-pyrazolo[4,3-c]pyridin-5-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone (CAS 87628-32-8) is a chemical compound with the molecular formula C14H14ClN3O and a molecular weight of 275.73 g/mol. IUPAC name: 1-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone. InChIKey: IZXBUXZTTXWVIR-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN3O |
|---|---|
| Molecular weight | 275.73 g/mol |
| IUPAC name | 1-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone |
| InChIKey | IZXBUXZTTXWVIR-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C(C1)C(=NN2)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)