Products 1185016-45-8
CAS 1185016-45-8 appears in our catalog under these names: Homovanillic Acid-13C6, >95% (HPLC), Homovanillic Acid-13C6. Offered by: TRC, MedChemExpress. Available pack sizes: 0,5mg, 10mg, 1mg, 1 mg.
2-(4-hydroxy-3-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)acetic acid (CAS 1185016-45-8) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 188.13 g/mol. IUPAC name: 2-(4-hydroxy-3-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)acetic acid. InChIKey: QRMZSPFSDQBLIX-BOCFXHSMSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 2-(4-hydroxy-3-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)acetic acid |
| InChIKey | QRMZSPFSDQBLIX-BOCFXHSMSA-N |
| SMILES | CO[13C]1=[13C]([13CH]=[13CH][13C](=[13CH]1)CC(=O)O)O |
Computed by PubChem (NCBI)