Products 53587-32-9
CAS 53587-32-9 appears in our catalog under these names: Homovanillic Acid-d5, >95% (HPLC), (4-Hydroxy-3-methoxyphenyl-2,5,6-d3)acetic-2,2-d2 Acid, 99 atom % D, min 98% Chemical Purity, Homovanillic acid-d5, Homovanillic acid–d5, Homovanillic acid-d5, 99.0%. Offered by: TRC, CDN, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 0,05g, 0,01g, 10mg, 25mg, 50mg.
2,2-dideuterio-2-(2,3,6-trideuterio-4-hydroxy-5-methoxyphenyl)acetic acid (CAS 53587-32-9) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 187.20 g/mol. IUPAC name: 2,2-dideuterio-2-(2,3,6-trideuterio-4-hydroxy-5-methoxyphenyl)acetic acid. InChIKey: QRMZSPFSDQBLIX-DVHRWRHBSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | 2,2-dideuterio-2-(2,3,6-trideuterio-4-hydroxy-5-methoxyphenyl)acetic acid |
| InChIKey | QRMZSPFSDQBLIX-DVHRWRHBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])C(=O)O)[2H])OC)O)[2H] |
Computed by PubChem (NCBI)