Products 74495-71-9
CAS 74495-71-9 appears in our catalog under these names: HOMOVANILLIC ACID-D3, Homovanillic Acid-d3, >95% (HPLC), Homovanillic acid-d3, 98.43%. Offered by: Chemat Brand, TRC, TargetMol, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg.
2-[4-hydroxy-3-(trideuteriomethoxy)phenyl]acetic acid (CAS 74495-71-9) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 185.19 g/mol. IUPAC name: 2-[4-hydroxy-3-(trideuteriomethoxy)phenyl]acetic acid. InChIKey: QRMZSPFSDQBLIX-FIBGUPNXSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 185.19 g/mol |
| IUPAC name | 2-[4-hydroxy-3-(trideuteriomethoxy)phenyl]acetic acid |
| InChIKey | QRMZSPFSDQBLIX-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)CC(=O)O)O |
Computed by PubChem (NCBI)