Products 53587-33-0
CAS 53587-33-0 appears in our catalog under these names: Adrenaline Impurity 44, (4-Hydroxy-3-methoxyphenyl)acetic-2,2-d2 Acid, 98 atom % D, min 98% Chemical Purity, Homovanillic acid-d2. Offered by: Chemat Brand, CDN, MedChemExpress. Available pack sizes: on request, 0,05g, 0,01g, 5 mg, 1 mg.
2,2-dideuterio-2-(4-hydroxy-3-methoxyphenyl)acetic acid (CAS 53587-33-0) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 184.19 g/mol. IUPAC name: 2,2-dideuterio-2-(4-hydroxy-3-methoxyphenyl)acetic acid. InChIKey: QRMZSPFSDQBLIX-BFWBPSQCSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2,2-dideuterio-2-(4-hydroxy-3-methoxyphenyl)acetic acid |
| InChIKey | QRMZSPFSDQBLIX-BFWBPSQCSA-N |
| SMILES | [2H]C([2H])(C1=CC(=C(C=C1)O)OC)C(=O)O |
Computed by PubChem (NCBI)