CAS 1185039-71-7 is the registry number for Quinmerac-13C6. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5mg.
7-chloro-3-methylquinoline-8-carboxylic acid (CAS 1185039-71-7) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 227.59 g/mol. IUPAC name: 7-chloro-3-methylquinoline-8-carboxylic acid. InChIKey: ALZOLUNSQWINIR-KIHIGKDESA-N.
| Molecular formula | C11H8ClNO2 |
|---|---|
| Molecular weight | 227.59 g/mol |
| IUPAC name | 7-chloro-3-methylquinoline-8-carboxylic acid |
| InChIKey | ALZOLUNSQWINIR-KIHIGKDESA-N |
| SMILES | CC1=C[13C]2=[13C]([13C](=[13C]([13CH]=[13CH]2)Cl)C(=O)O)N=C1 |
Computed by PubChem (NCBI)