Products 1185039-71-7

CAS 1185039-71-7 is the registry number for Quinmerac-13C6. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5mg.

7-chloro-3-methylquinoline-8-carboxylic acid (CAS 1185039-71-7) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 227.59 g/mol. IUPAC name: 7-chloro-3-methylquinoline-8-carboxylic acid. InChIKey: ALZOLUNSQWINIR-KIHIGKDESA-N.

Identity
Molecular formulaC11H8ClNO2
Molecular weight227.59 g/mol
IUPAC name7-chloro-3-methylquinoline-8-carboxylic acid
InChIKeyALZOLUNSQWINIR-KIHIGKDESA-N
SMILESCC1=C[13C]2=[13C]([13C](=[13C]([13CH]=[13CH]2)Cl)C(=O)O)N=C1

Computed by PubChem (NCBI)