Products 2733717-04-7
CAS 2733717-04-7 is the registry number for Quinmerac D4 100 µg/mL in Acetonitrile. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.
7-chloro-2-deuterio-3-(trideuteriomethyl)quinoline-8-carboxylic acid (CAS 2733717-04-7) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 225.66 g/mol. IUPAC name: 7-chloro-2-deuterio-3-(trideuteriomethyl)quinoline-8-carboxylic acid. InChIKey: ALZOLUNSQWINIR-DUVDRHTGSA-N.
| Molecular formula | C11H8ClNO2 |
|---|---|
| Molecular weight | 225.66 g/mol |
| IUPAC name | 7-chloro-2-deuterio-3-(trideuteriomethyl)quinoline-8-carboxylic acid |
| InChIKey | ALZOLUNSQWINIR-DUVDRHTGSA-N |
| SMILES | [2H]C1=NC2=C(C=CC(=C2C(=O)O)Cl)C=C1C([2H])([2H])[2H] |
Computed by PubChem (NCBI)