Products 1185071-99-1
CAS 1185071-99-1 appears in our catalog under these names: Flufenamic Acid–d4, Flufenamic Acid-d4. Offered by: GLPBio, Chemat Brand, Hubei YoungXin, TRC, TargetMol. Available pack sizes: 1mg, on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500μg.
2,3,4,5-tetradeuterio-6-[3-(trifluoromethyl)anilino]benzoic acid (CAS 1185071-99-1) is a chemical compound with the molecular formula C14H10F3NO2 and a molecular weight of 285.25 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-[3-(trifluoromethyl)anilino]benzoic acid. InChIKey: LPEPZBJOKDYZAD-ZEJCXXMWSA-N.
| Molecular formula | C14H10F3NO2 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-[3-(trifluoromethyl)anilino]benzoic acid |
| InChIKey | LPEPZBJOKDYZAD-ZEJCXXMWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)NC2=CC=CC(=C2)C(F)(F)F)[2H])[2H] |
Computed by PubChem (NCBI)