CAS 87789-82-0 is the registry number for Methyl 5-(3-(trifluoromethyl)phenyl)picolinate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 5-[3-(trifluoromethyl)phenyl]pyridine-2-carboxylate (CAS 87789-82-0) is a chemical compound with the molecular formula C14H10F3NO2 and a molecular weight of 281.23 g/mol. IUPAC name: methyl 5-[3-(trifluoromethyl)phenyl]pyridine-2-carboxylate. InChIKey: KANJOPRAQVZBNG-UHFFFAOYSA-N.
| Molecular formula | C14H10F3NO2 |
|---|---|
| Molecular weight | 281.23 g/mol |
| IUPAC name | methyl 5-[3-(trifluoromethyl)phenyl]pyridine-2-carboxylate |
| InChIKey | KANJOPRAQVZBNG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=C(C=C1)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)