CAS 69392-32-1 appears in our catalog under these names: N-(3-Hydroxyphenyl)-2-(trifluoromethyl)benzamide, Flutolanil metabolite M4. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 1g, 25mg.
N-(3-hydroxyphenyl)-2-(trifluoromethyl)benzamide (CAS 69392-32-1) is a chemical compound with the molecular formula C14H10F3NO2 and a molecular weight of 281.23 g/mol. IUPAC name: N-(3-hydroxyphenyl)-2-(trifluoromethyl)benzamide. InChIKey: YUWVGNPIDBYWEW-UHFFFAOYSA-N.
| Molecular formula | C14H10F3NO2 |
|---|---|
| Molecular weight | 281.23 g/mol |
| IUPAC name | N-(3-hydroxyphenyl)-2-(trifluoromethyl)benzamide |
| InChIKey | YUWVGNPIDBYWEW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC(=CC=C2)O)C(F)(F)F |
Computed by PubChem (NCBI)