CAS 1284180-11-5 appears in our catalog under these names: 3-((4-(Trifluoromethyl)phenyl)amino)benzoic acid, 95%, AKR1C3–IN–4, AKR1C3-IN-4, AKR1C3 Inhibitor 1PC X 25MG, 3-((4-(Trifluoromethyl)phenyl)amino)benzoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, TargetMol, Sigma-Aldrich, Chemat. Available pack sizes: 250mg, 1g, 50mg, 25MG, 50 mg, 10mM/1mL, 100mg, 5g.
3-[4-(trifluoromethyl)anilino]benzoic acid (CAS 1284180-11-5) is a chemical compound with the molecular formula C14H10F3NO2 and a molecular weight of 281.23 g/mol. IUPAC name: 3-[4-(trifluoromethyl)anilino]benzoic acid. InChIKey: MDZIRNPRVJEHHX-UHFFFAOYSA-N.
| Molecular formula | C14H10F3NO2 |
|---|---|
| Molecular weight | 281.23 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)anilino]benzoic acid |
| InChIKey | MDZIRNPRVJEHHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC2=CC=C(C=C2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)