Products 1185106-66-4
CAS 1185106-66-4 appears in our catalog under these names: Meprobamate-D3, Meprobamate-d3 (methyl-d3), 99 atom % D, min 98% Chemical Purity, Meprobamate-d3 (100 μg/mL in Methanol). Offered by: TRC, CDN, Biosynth. Available pack sizes: 2,5mg, 25mg, 0,1g, 0,05g, 2x1ml, 50mg.
[2-(carbamoyloxymethyl)-2-(trideuteriomethyl)pentyl] carbamate (CAS 1185106-66-4) is a chemical compound with the molecular formula C9H18N2O4 and a molecular weight of 221.27 g/mol. IUPAC name: [2-(carbamoyloxymethyl)-2-(trideuteriomethyl)pentyl] carbamate. InChIKey: NPPQSCRMBWNHMW-BMSJAHLVSA-N.
| Molecular formula | C9H18N2O4 |
|---|---|
| Molecular weight | 221.27 g/mol |
| IUPAC name | [2-(carbamoyloxymethyl)-2-(trideuteriomethyl)pentyl] carbamate |
| InChIKey | NPPQSCRMBWNHMW-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])C(CCC)(COC(=O)N)COC(=O)N |
Computed by PubChem (NCBI)