CAS 1435933-83-7 is the registry number for Meprobamate-d7 (100 μg/mL in Methanol). Offered by: TRC. Available pack sizes: 5x1ml.
[2-(carbamoyloxymethyl)-3,3,4,4,5,5,5-heptadeuterio-2-methylpentyl] carbamate (CAS 1435933-83-7) is a chemical compound with the molecular formula C9H18N2O4 and a molecular weight of 225.29 g/mol. IUPAC name: [2-(carbamoyloxymethyl)-3,3,4,4,5,5,5-heptadeuterio-2-methylpentyl] carbamate. InChIKey: NPPQSCRMBWNHMW-SSQNFVSCSA-N.
| Molecular formula | C9H18N2O4 |
|---|---|
| Molecular weight | 225.29 g/mol |
| IUPAC name | [2-(carbamoyloxymethyl)-3,3,4,4,5,5,5-heptadeuterio-2-methylpentyl] carbamate |
| InChIKey | NPPQSCRMBWNHMW-SSQNFVSCSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C(C)(COC(=O)N)COC(=O)N |
Computed by PubChem (NCBI)