Products 1185130-51-1
CAS 1185130-51-1 appears in our catalog under these names: Normesuximide-d5, Normesuximide-d5, >95% (HPLC). Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg, 10 mg.
3-methyl-3-(2,3,4,5,6-pentadeuteriophenyl)pyrrolidine-2,5-dione (CAS 1185130-51-1) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 194.24 g/mol. IUPAC name: 3-methyl-3-(2,3,4,5,6-pentadeuteriophenyl)pyrrolidine-2,5-dione. InChIKey: UDESUGJZUFALAM-VIQYUKPQSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 194.24 g/mol |
| IUPAC name | 3-methyl-3-(2,3,4,5,6-pentadeuteriophenyl)pyrrolidine-2,5-dione |
| InChIKey | UDESUGJZUFALAM-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2(CC(=O)NC2=O)C)[2H])[2H] |
Computed by PubChem (NCBI)