Products 1185132-92-6
CAS 1185132-92-6 appears in our catalog under these names: Norfluoxetine-d5 Hydrochloride, >95% (HPLC), (±)-Norfluoxetine-d5 HCl (propyl-1,1,2,2,3-d5), 98 atom % D, min 98% Chemical Purity, Norfluoxetine–d5 (hydrochloride), Norfluoxetine-d5 HCl, Norfluoxetine-d5. Offered by: TRC, CDN, GLPBio, TargetMol, MedChemExpress. Available pack sizes: 10mg, 1mg, 2,5mg, 0,01g, 0,005g, 5mg, 1 mg.
1,1,2,2,3-pentadeuterio-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride (CAS 1185132-92-6) is a chemical compound with the molecular formula C16H17ClF3NO and a molecular weight of 336.79 g/mol. IUPAC name: 1,1,2,2,3-pentadeuterio-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride. InChIKey: GMTWWEPBGGXBTO-KDPCSTGBSA-N.
| Molecular formula | C16H17ClF3NO |
|---|---|
| Molecular weight | 336.79 g/mol |
| IUPAC name | 1,1,2,2,3-pentadeuterio-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride |
| InChIKey | GMTWWEPBGGXBTO-KDPCSTGBSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])N)C([2H])(C1=CC=CC=C1)OC2=CC=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)