CAS 57226-68-3 appears in our catalog under these names: 3-Phenyl-3-(4-(trifluoromethyl)phenoxy)propan-1-amine hydrochloride, 98%, Norfluoxetine HCl, Norfluoxetine Hydrochloride, >95% (HPLC), Norfluoxetine hydrochloride, Norfluoxetine.HCl. Offered by: Fluorochem, Chemat Brand, TRC, Dr. Ehrenstorfer, Lipomed. Available pack sizes: 10mg, 50mg, 100mg, 250mg, 1g, on request, 2mg, 25mg.
3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride (CAS 57226-68-3) is a chemical compound with the molecular formula C16H17ClF3NO and a molecular weight of 331.76 g/mol. IUPAC name: 3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride. InChIKey: GMTWWEPBGGXBTO-UHFFFAOYSA-N.
| Molecular formula | C16H17ClF3NO |
|---|---|
| Molecular weight | 331.76 g/mol |
| IUPAC name | 3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride |
| InChIKey | GMTWWEPBGGXBTO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CCN)OC2=CC=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)