Products 1188265-34-0
CAS 1188265-34-0 appears in our catalog under these names: Norfluoxetine-d5 HCl, Norfluoxetine-d5 Hydrochloride (Phenyl-d5), >95% (HPLC), Norfluoxetine-d5 hydrochloride (phenyl-d5), Norfluoxetine-d5 (hydrochloride), 99.30%. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 2mg, 5mg, 5 mg, 10 mg, 1 mg.
3-(2,3,4,5,6-pentadeuteriophenyl)-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride (CAS 1188265-34-0) is a chemical compound with the molecular formula C16H17ClF3NO and a molecular weight of 336.79 g/mol. IUPAC name: 3-(2,3,4,5,6-pentadeuteriophenyl)-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride. InChIKey: GMTWWEPBGGXBTO-GWVWGMRQSA-N.
| Molecular formula | C16H17ClF3NO |
|---|---|
| Molecular weight | 336.79 g/mol |
| IUPAC name | 3-(2,3,4,5,6-pentadeuteriophenyl)-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride |
| InChIKey | GMTWWEPBGGXBTO-GWVWGMRQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(CCN)OC2=CC=C(C=C2)C(F)(F)F)[2H])[2H].Cl |
Computed by PubChem (NCBI)