CAS 138614-32-1 is the registry number for (3R)-3-Phenyl-3-(4-(Trifluoromethyl)Phenoxy)-1-Propanamine Hydrochloride (1:1). Offered by: Biosynth. Available pack sizes: 50mg.
(3R)-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride (CAS 138614-32-1) is a chemical compound with the molecular formula C16H17ClF3NO and a molecular weight of 331.76 g/mol. IUPAC name: (3R)-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride. InChIKey: GMTWWEPBGGXBTO-XFULWGLBSA-N.
| Molecular formula | C16H17ClF3NO |
|---|---|
| Molecular weight | 331.76 g/mol |
| IUPAC name | (3R)-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride |
| InChIKey | GMTWWEPBGGXBTO-XFULWGLBSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](CCN)OC2=CC=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)