Products 1185133-81-6
CAS 1185133-81-6 appears in our catalog under these names: Flurbiprofen-d3, Flurbiprofen-d3, >95% (HPLC), Flurbiprofen–d3, Flurbiprofen-d3, 99.87%, D3-Flurbiprofen. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress, HPC Standards. Available pack sizes: on request, 50mg, 5mg, 1mg, 500μg, 10 mg, 5 mg, 1 mg.
3,3,3-trideuterio-2-(3-fluoro-4-phenylphenyl)propanoic acid (CAS 1185133-81-6) is a chemical compound with the molecular formula C15H13FO2 and a molecular weight of 247.28 g/mol. IUPAC name: 3,3,3-trideuterio-2-(3-fluoro-4-phenylphenyl)propanoic acid. InChIKey: SYTBZMRGLBWNTM-FIBGUPNXSA-N.
| Molecular formula | C15H13FO2 |
|---|---|
| Molecular weight | 247.28 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-(3-fluoro-4-phenylphenyl)propanoic acid |
| InChIKey | SYTBZMRGLBWNTM-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC(=C(C=C1)C2=CC=CC=C2)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(2-Fluoro(1,1'-biphenyl)-4-yl)(3,3,3-~2~H_3_)propanoic acid, 2-(2-Fluoro[1,1'-biphenyl]-4-yl)(3,3,3-~2~H_3_)propanoic acid, Flurbiprofen-d3, 3,3,3-trideuterio-2-(3-fluoro-4-phenylphenyl)propanoic acid, 3,3,3-trideuterio-2-(3-fluoro-4-phenyl-phenyl)propanoic acid, 2-{2-fluoro-[1,1'-biphenyl]-4-yl}(3,3,3-?H?)propanoic acid