Products 215175-76-1
CAS 215175-76-1 appears in our catalog under these names: Flurbiprofen-d5, >95% (HPLC), (±)-Flurbiprofen-d5 (phenyl-d5), 99 atom % D, min 98% Chemical Purity, Flurbiprofen–d5, Flurbiprofen-d5, 99.76%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 0,05g, 0,01g, 1 mg, 5 mg.
2-[3-fluoro-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]propanoic acid (CAS 215175-76-1) is a chemical compound with the molecular formula C15H13FO2 and a molecular weight of 249.29 g/mol. IUPAC name: 2-[3-fluoro-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]propanoic acid. InChIKey: SYTBZMRGLBWNTM-VIQYUKPQSA-N.
| Molecular formula | C15H13FO2 |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | 2-[3-fluoro-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]propanoic acid |
| InChIKey | SYTBZMRGLBWNTM-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C=C(C=C2)C(C)C(=O)O)F)[2H])[2H] |
Computed by PubChem (NCBI)