CAS 1185236-01-4 is the registry number for 4-[(E)-2-(3-Fluorophenyl)vinyl]pyridine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-[(E)-2-(3-fluorophenyl)ethenyl]pyridine;hydrochloride (CAS 1185236-01-4) is a chemical compound with the molecular formula C13H11ClFN and a molecular weight of 235.68 g/mol. IUPAC name: 4-[(E)-2-(3-fluorophenyl)ethenyl]pyridine;hydrochloride. InChIKey: WZYUISZFYKATLL-FXRZFVDSSA-N.
| Molecular formula | C13H11ClFN |
|---|---|
| Molecular weight | 235.68 g/mol |
| IUPAC name | 4-[(E)-2-(3-fluorophenyl)ethenyl]pyridine;hydrochloride |
| InChIKey | WZYUISZFYKATLL-FXRZFVDSSA-N |
| SMILES | C1=CC(=CC(=C1)F)/C=C/C2=CC=NC=C2.Cl |
Computed by PubChem (NCBI)