Products 1341318-54-4
CAS 1341318-54-4 is the registry number for (3-Chloro-2-fluorophenyl)(phenyl)methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3-chloro-2-fluorophenyl)-phenylmethanamine (CAS 1341318-54-4) is a chemical compound with the molecular formula C13H11ClFN and a molecular weight of 235.68 g/mol. IUPAC name: (3-chloro-2-fluorophenyl)-phenylmethanamine. InChIKey: NRDSIVMVXSIWEN-UHFFFAOYSA-N.
| Molecular formula | C13H11ClFN |
|---|---|
| Molecular weight | 235.68 g/mol |
| IUPAC name | (3-chloro-2-fluorophenyl)-phenylmethanamine |
| InChIKey | NRDSIVMVXSIWEN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=C(C(=CC=C2)Cl)F)N |
Computed by PubChem (NCBI)