Products 906371-83-3
CAS 906371-83-3 is the registry number for N-(2-Chloro-4-fluorophenyl)benzenemethanamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
N-benzyl-2-chloro-4-fluoroaniline (CAS 906371-83-3) is a chemical compound with the molecular formula C13H11ClFN and a molecular weight of 235.68 g/mol. IUPAC name: N-benzyl-2-chloro-4-fluoroaniline. InChIKey: KNXCQJPGPASKES-UHFFFAOYSA-N.
| Molecular formula | C13H11ClFN |
|---|---|
| Molecular weight | 235.68 g/mol |
| IUPAC name | N-benzyl-2-chloro-4-fluoroaniline |
| InChIKey | KNXCQJPGPASKES-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C(C=C(C=C2)F)Cl |
Computed by PubChem (NCBI)