CAS 723753-84-2 is the registry number for 4-Chloro-n-(2-fluorobenzyl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-chloro-N-[(2-fluorophenyl)methyl]aniline (CAS 723753-84-2) is a chemical compound with the molecular formula C13H11ClFN and a molecular weight of 235.68 g/mol. IUPAC name: 4-chloro-N-[(2-fluorophenyl)methyl]aniline. InChIKey: QCLJXZCWBRKJHD-UHFFFAOYSA-N.
| Molecular formula | C13H11ClFN |
|---|---|
| Molecular weight | 235.68 g/mol |
| IUPAC name | 4-chloro-N-[(2-fluorophenyl)methyl]aniline |
| InChIKey | QCLJXZCWBRKJHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC2=CC=C(C=C2)Cl)F |
Computed by PubChem (NCBI)