Products 1185239-59-1
CAS 1185239-59-1 appears in our catalog under these names: trans,trans-Muconic Acid-d4, >95% (HPLC), trans,trans–Muconic Acid–d4, Muconic acid-d4. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 0,5mg, 5mg, 500μg, 500 μg.
(2E,4E)-2,3,4,5-tetradeuteriohexa-2,4-dienedioic acid (CAS 1185239-59-1) is a chemical compound with the molecular formula C6H6O4 and a molecular weight of 146.13 g/mol. IUPAC name: (2E,4E)-2,3,4,5-tetradeuteriohexa-2,4-dienedioic acid. InChIKey: TXXHDPDFNKHHGW-NFCKNUJASA-N.
| Molecular formula | C6H6O4 |
|---|---|
| Molecular weight | 146.13 g/mol |
| IUPAC name | (2E,4E)-2,3,4,5-tetradeuteriohexa-2,4-dienedioic acid |
| InChIKey | TXXHDPDFNKHHGW-NFCKNUJASA-N |
| SMILES | [2H]/C(=C(\C(=O)O)/[2H])/C(=C(/C(=O)O)\[2H])/[2H] |
Computed by PubChem (NCBI)